C15H24N2O2S — CID 56790214
3-(ethoxymethyl)-N-[(3-methylthiophen-2-yl)methyl]piperidine-1-carboxamide (PubChem CID 56790214) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-(ethoxymethyl)-N-[(3-methylthiophen-2-yl)methyl]piperidine-1-carboxamide.
| Compound Name | 3-(ethoxymethyl)-N-[(3-methylthiophen-2-yl)methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 56790214 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-(ethoxymethyl)-N-[(3-methylthiophen-2-yl)methyl]piperidine-1-carboxamide |
| SMILES | CCOCC1CCCN(C(=O)NCc2sccc2C)C1 |
| InChI | InChI=1S/C15H24N2O2S/c1-3-19-11-13-5-4-7-17(10-13)15(18)16-9-14-12(2)6-8-20-14/h6,8,13H,3-5,7,9-11H2,1-2H3,(H,16,18) |
| InChIKey | BFPVDDHIZDBKTH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |