C14H23N3OS — CID 119920391
2-[3-(methylamino)piperidin-1-yl]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 119920391) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 119920391 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CNC1CCCN(CC(=O)NCc2sccc2C)C1 |
| InChI | InChI=1S/C14H23N3OS/c1-11-5-7-19-13(11)8-16-14(18)10-17-6-3-4-12(9-17)15-2/h5,7,12,15H,3-4,6,8-10H2,1-2H3,(H,16,18) |
| InChIKey | MQWIGYXVWLENIK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |