C16H22N4OS — CID 95760359
N-[(3-methylthiophen-2-yl)methyl]-2-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]acetamide (PubChem CID 95760359) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is N-[(3-methylthiophen-2-yl)methyl]-2-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]acetamide.
| Compound Name | N-[(3-methylthiophen-2-yl)methyl]-2-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 95760359 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | N-[(3-methylthiophen-2-yl)methyl]-2-[(3S)-3-(1H-pyrazol-5-yl)piperidin-1-yl]acetamide |
| SMILES | Cc1ccsc1CNC(=O)CN1CCC[C@H](c2ccn[nH]2)C1 |
| InChI | InChI=1S/C16H22N4OS/c1-12-5-8-22-15(12)9-17-16(21)11-20-7-2-3-13(10-20)14-4-6-18-19-14/h4-6,8,13H,2-3,7,9-11H2,1H3,(H,17,21)(H,18,19)/t13-/m0/s1 |
| InChIKey | WTTKOMRMUJINCJ-ZDUSSCGKSA-N |
| XLogP | 2.28 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |