C18H18FN3O5 — CID 139599744
(3aR,6aR)-5-[3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 139599744) has the molecular formula C18H18FN3O5 and a molecular weight of 375.36 g/mol. Its IUPAC name is (3aR,6aR)-5-[3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,6aR)-5-[3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 139599744 |
| Molecular Formula | C18H18FN3O5 |
| Molecular Weight | 375.36 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (3aR,6aR)-5-[3-[3-(2-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-3,4,6,6a-tetrahydro-1H-furo[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(CCc1nc(-c2ccccc2F)no1)N1C[C@@H]2COC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C18H18FN3O5/c19-13-4-2-1-3-12(13)16-20-14(27-21-16)5-6-15(23)22-7-11-8-26-10-18(11,9-22)17(24)25/h1-4,11H,5-10H2,(H,24,25)/t11-,18-/m1/s1 |
| InChIKey | IGLIBVXEKGEION-ADLMAVQZSA-N |
| XLogP | 1.37 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.36 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |