C17H20FNO4 — CID 120628090
(3aS,7aS)-2-[3-(4-fluorophenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120628090) has the molecular formula C17H20FNO4 and a molecular weight of 321.35 g/mol. Its IUPAC name is (3aS,7aS)-2-[3-(4-fluorophenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[3-(4-fluorophenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120628090 |
| Molecular Formula | C17H20FNO4 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3aS,7aS)-2-[3-(4-fluorophenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(CCc1ccc(F)cc1)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C17H20FNO4/c18-14-4-1-12(2-5-14)3-6-15(20)19-9-13-10-23-8-7-17(13,11-19)16(21)22/h1-2,4-5,13H,3,6-11H2,(H,21,22)/t13-,17+/m0/s1 |
| InChIKey | IAFQHKVNZQNAEK-SUMWQHHRSA-N |
| XLogP | 1.71 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |