C21H29NO4 — CID 120627562
(3aS,7aS)-2-[3-(4-tert-butylphenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120627562) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3aS,7aS)-2-[3-(4-tert-butylphenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[3-(4-tert-butylphenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120627562 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (3aS,7aS)-2-[3-(4-tert-butylphenyl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(CCC(=O)N2C[C@H]3COCC[C@@]3(C(=O)O)C2)cc1 |
| InChI | InChI=1S/C21H29NO4/c1-20(2,3)16-7-4-15(5-8-16)6-9-18(23)22-12-17-13-26-11-10-21(17,14-22)19(24)25/h4-5,7-8,17H,6,9-14H2,1-3H3,(H,24,25)/t17-,21+/m0/s1 |
| InChIKey | RSZLGGAVEVIRKK-LAUBAEHRSA-N |
| XLogP | 2.87 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |