C19H21N3O5 — CID 137337757
(3aR,7aR)-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 137337757) has the molecular formula C19H21N3O5 and a molecular weight of 371.39 g/mol. Its IUPAC name is (3aR,7aR)-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 137337757 |
| Molecular Formula | C19H21N3O5 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (3aR,7aR)-2-[3-(3-oxo-4H-quinoxalin-2-yl)propanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(CCc1nc2ccccc2[nH]c1=O)N1C[C@@H]2COCC[C@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H21N3O5/c23-16(22-9-12-10-27-8-7-19(12,11-22)18(25)26)6-5-15-17(24)21-14-4-2-1-3-13(14)20-15/h1-4,12H,5-11H2,(H,21,24)(H,25,26)/t12-,19+/m1/s1 |
| InChIKey | ZYLIWWBEMCOQAM-BLVKFPJESA-N |
| XLogP | 0.81 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |