C20H23NO4S — CID 120628897
(3aS,7aS)-2-[4-(1-benzothiophen-3-yl)butanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid (PubChem CID 120628897) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is (3aS,7aS)-2-[4-(1-benzothiophen-3-yl)butanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid.
| Compound Name | (3aS,7aS)-2-[4-(1-benzothiophen-3-yl)butanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
|---|---|
| PubChem CID | 120628897 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (3aS,7aS)-2-[4-(1-benzothiophen-3-yl)butanoyl]-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrole-7a-carboxylic acid |
| SMILES | O=C(CCCc1csc2ccccc12)N1C[C@H]2COCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C20H23NO4S/c22-18(7-3-4-14-12-26-17-6-2-1-5-16(14)17)21-10-15-11-25-9-8-20(15,13-21)19(23)24/h1-2,5-6,12,15H,3-4,7-11,13H2,(H,23,24)/t15-,20+/m0/s1 |
| InChIKey | RAHRITJIIBIXLI-MGPUTAFESA-N |
| XLogP | 3.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |