C12H12N2OS — CID 142882532
1-[5-methyl-2-(1,3-thiazol-2-yl)anilino]ethenol (PubChem CID 142882532) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 1-[5-methyl-2-(1,3-thiazol-2-yl)anilino]ethenol.
| Compound Name | 1-[5-methyl-2-(1,3-thiazol-2-yl)anilino]ethenol |
|---|---|
| PubChem CID | 142882532 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-[5-methyl-2-(1,3-thiazol-2-yl)anilino]ethenol |
| SMILES | C=C(O)Nc1cc(C)ccc1-c1nccs1 |
| InChI | InChI=1S/C12H12N2OS/c1-8-3-4-10(12-13-5-6-16-12)11(7-8)14-9(2)15/h3-7,14-15H,2H2,1H3 |
| InChIKey | VCWUJDCNQKYIEM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|