C14H18N2O2S2 — CID 110716059
N,2,4-trimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 110716059) has the molecular formula C14H18N2O2S2 and a molecular weight of 310.44 g/mol. Its IUPAC name is N,2,4-trimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | N,2,4-trimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110716059 |
| Molecular Formula | C14H18N2O2S2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | N,2,4-trimethyl-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CCc2nccs2)c(C)c1 |
| InChI | InChI=1S/C14H18N2O2S2/c1-11-4-5-13(12(2)10-11)20(17,18)16(3)8-6-14-15-7-9-19-14/h4-5,7,9-10H,6,8H2,1-3H3 |
| InChIKey | QAGSYLURGGRTKU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |