C11H11N3O2S2 — CID 2825089
4-methyl-N-(1,3-thiazol-2-ylmethylideneamino)benzenesulfonamide (PubChem CID 2825089) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 4-methyl-N-(1,3-thiazol-2-ylmethylideneamino)benzenesulfonamide.
| Compound Name | 4-methyl-N-(1,3-thiazol-2-ylmethylideneamino)benzenesulfonamide |
|---|---|
| PubChem CID | 2825089 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 4-methyl-N-(1,3-thiazol-2-ylmethylideneamino)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2nccs2)cc1 |
| InChI | InChI=1S/C11H11N3O2S2/c1-9-2-4-10(5-3-9)18(15,16)14-13-8-11-12-6-7-17-11/h2-8,14H,1H3 |
| InChIKey | IVSUKUDJFRFLMZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|