C13H11N3O2S2 — CID 67256774
N-[(5-cyanothiophen-2-yl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 67256774) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[(5-cyanothiophen-2-yl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(5-cyanothiophen-2-yl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67256774 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | N-[(5-cyanothiophen-2-yl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NN=Cc2ccc(C#N)s2)cc1 |
| InChI | InChI=1S/C13H11N3O2S2/c1-10-2-6-13(7-3-10)20(17,18)16-15-9-12-5-4-11(8-14)19-12/h2-7,9,16H,1H3 |
| InChIKey | OQOGOXLCLFMAQK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|