C23H32N2O6S — CID 123727057
2-(dibutylamino)-4-(4-methoxyphenoxy)-5-(methylsulfamoyl)benzoic acid (PubChem CID 123727057) has the molecular formula C23H32N2O6S and a molecular weight of 464.58 g/mol. Its IUPAC name is 2-(dibutylamino)-4-(4-methoxyphenoxy)-5-(methylsulfamoyl)benzoic acid.
| Compound Name | 2-(dibutylamino)-4-(4-methoxyphenoxy)-5-(methylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 123727057 |
| Molecular Formula | C23H32N2O6S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-(dibutylamino)-4-(4-methoxyphenoxy)-5-(methylsulfamoyl)benzoic acid |
| SMILES | CCCCN(CCCC)c1cc(Oc2ccc(OC)cc2)c(S(=O)(=O)NC)cc1C(=O)O |
| InChI | InChI=1S/C23H32N2O6S/c1-5-7-13-25(14-8-6-2)20-16-21(31-18-11-9-17(30-4)10-12-18)22(32(28,29)24-3)15-19(20)23(26)27/h9-12,15-16,24H,5-8,13-14H2,1-4H3,(H,26,27) |
| InChIKey | LFBVTJPMOMIDTG-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |