C13H12ClNO3 — CID 84640028
2-chloro-5,7-dimethoxy-4-methylquinoline-3-carbaldehyde (PubChem CID 84640028) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is 2-chloro-5,7-dimethoxy-4-methylquinoline-3-carbaldehyde.
| Compound Name | 2-chloro-5,7-dimethoxy-4-methylquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 84640028 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 2-chloro-5,7-dimethoxy-4-methylquinoline-3-carbaldehyde |
| SMILES | COc1cc(OC)c2c(C)c(C=O)c(Cl)nc2c1 |
| InChI | InChI=1S/C13H12ClNO3/c1-7-9(6-16)13(14)15-10-4-8(17-2)5-11(18-3)12(7)10/h4-6H,1-3H3 |
| InChIKey | YIISTPGCEUAMNA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|