C15H13ClN2O2S — CID 114591327
4-chloro-5,7-dimethoxy-2-(3-methylthiophen-2-yl)quinazoline (PubChem CID 114591327) has the molecular formula C15H13ClN2O2S and a molecular weight of 320.80 g/mol. Its IUPAC name is 4-chloro-5,7-dimethoxy-2-(3-methylthiophen-2-yl)quinazoline.
| Compound Name | 4-chloro-5,7-dimethoxy-2-(3-methylthiophen-2-yl)quinazoline |
|---|---|
| PubChem CID | 114591327 |
| Molecular Formula | C15H13ClN2O2S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 4-chloro-5,7-dimethoxy-2-(3-methylthiophen-2-yl)quinazoline |
| SMILES | COc1cc(OC)c2c(Cl)nc(-c3sccc3C)nc2c1 |
| InChI | InChI=1S/C15H13ClN2O2S/c1-8-4-5-21-13(8)15-17-10-6-9(19-2)7-11(20-3)12(10)14(16)18-15/h4-7H,1-3H3 |
| InChIKey | WXLXFNSNAWIHIE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |