C15H22ClN — CID 142294625
7-chloro-3,4-dimethylisoquinoline;ethane (PubChem CID 142294625) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is 7-chloro-3,4-dimethylisoquinoline;ethane.
| Compound Name | 7-chloro-3,4-dimethylisoquinoline;ethane |
|---|---|
| PubChem CID | 142294625 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 7-chloro-3,4-dimethylisoquinoline;ethane |
| SMILES | CC.CC.Cc1ncc2cc(Cl)ccc2c1C |
| InChI | InChI=1S/C11H10ClN.2C2H6/c1-7-8(2)13-6-9-5-10(12)3-4-11(7)9;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | VMLKBPPMZNZZFD-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |