C14H11ClN2 — CID 53242883
9-chloro-2,3-dimethylbenzo[h][1,6]naphthyridine (PubChem CID 53242883) has the molecular formula C14H11ClN2 and a molecular weight of 242.71 g/mol. Its IUPAC name is 9-chloro-2,3-dimethylbenzo[h][1,6]naphthyridine.
| Compound Name | 9-chloro-2,3-dimethylbenzo[h][1,6]naphthyridine |
|---|---|
| PubChem CID | 53242883 |
| Molecular Formula | C14H11ClN2 |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 9-chloro-2,3-dimethylbenzo[h][1,6]naphthyridine |
| SMILES | Cc1cc2cnc3ccc(Cl)cc3c2nc1C |
| InChI | InChI=1S/C14H11ClN2/c1-8-5-10-7-16-13-4-3-11(15)6-12(13)14(10)17-9(8)2/h3-7H,1-2H3 |
| InChIKey | IZGZTTXNFKZFIL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|