C18H14N2 — CID 621066
9,10-dimethylquinolino[4,3-b]quinoline (PubChem CID 621066) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 9,10-dimethylquinolino[4,3-b]quinoline.
| Compound Name | 9,10-dimethylquinolino[4,3-b]quinoline |
|---|---|
| PubChem CID | 621066 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 9,10-dimethylquinolino[4,3-b]quinoline |
| SMILES | Cc1cc2cc3cnc4ccccc4c3nc2cc1C |
| InChI | InChI=1S/C18H14N2/c1-11-7-13-9-14-10-19-16-6-4-3-5-15(16)18(14)20-17(13)8-12(11)2/h3-10H,1-2H3 |
| InChIKey | VHVDJSZDCAHHPH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|