C9H6Cl2O — CID 151191447
2,6-dichloro-3-methyl-1-benzofuran (PubChem CID 151191447) has the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. Its IUPAC name is 2,6-dichloro-3-methyl-1-benzofuran.
| Compound Name | 2,6-dichloro-3-methyl-1-benzofuran |
|---|---|
| PubChem CID | 151191447 |
| Molecular Formula | C9H6Cl2O |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 2,6-dichloro-3-methyl-1-benzofuran |
| SMILES | Cc1c(Cl)oc2cc(Cl)ccc12 |
| InChI | InChI=1S/C9H6Cl2O/c1-5-7-3-2-6(10)4-8(7)12-9(5)11/h2-4H,1H3 |
| InChIKey | NGJZTMJQWOEXIM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |