C10H9Cl2N — CID 117127818
2,6-dichloro-1,3-dimethylindole (PubChem CID 117127818) has the molecular formula C10H9Cl2N and a molecular weight of 214.09 g/mol. Its IUPAC name is 2,6-dichloro-1,3-dimethylindole.
| Compound Name | 2,6-dichloro-1,3-dimethylindole |
|---|---|
| PubChem CID | 117127818 |
| Molecular Formula | C10H9Cl2N |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 2,6-dichloro-1,3-dimethylindole |
| SMILES | Cc1c(Cl)n(C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C10H9Cl2N/c1-6-8-4-3-7(11)5-9(8)13(2)10(6)12/h3-5H,1-2H3 |
| InChIKey | FVTWBXPFXXPAGK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |