C13H17ClN2 — CID 82496941
3-(6-chloro-2,3-dimethylindol-1-yl)propan-1-amine (PubChem CID 82496941) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 3-(6-chloro-2,3-dimethylindol-1-yl)propan-1-amine.
| Compound Name | 3-(6-chloro-2,3-dimethylindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 82496941 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 3-(6-chloro-2,3-dimethylindol-1-yl)propan-1-amine |
| SMILES | Cc1c(C)n(CCCN)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H17ClN2/c1-9-10(2)16(7-3-6-15)13-8-11(14)4-5-12(9)13/h4-5,8H,3,6-7,15H2,1-2H3 |
| InChIKey | DSBTWFSTHKFNIJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|