C14H19ClN2O — CID 82501761
3-(6-chloro-5-methoxy-2,3-dimethylindol-1-yl)propan-1-amine (PubChem CID 82501761) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 3-(6-chloro-5-methoxy-2,3-dimethylindol-1-yl)propan-1-amine.
| Compound Name | 3-(6-chloro-5-methoxy-2,3-dimethylindol-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 82501761 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 3-(6-chloro-5-methoxy-2,3-dimethylindol-1-yl)propan-1-amine |
| SMILES | COc1cc2c(C)c(C)n(CCCN)c2cc1Cl |
| InChI | InChI=1S/C14H19ClN2O/c1-9-10(2)17(6-4-5-16)13-8-12(15)14(18-3)7-11(9)13/h7-8H,4-6,16H2,1-3H3 |
| InChIKey | YLNUBBWDERGOIO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|