About 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine
2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine (PubChem CID 84639810) has the molecular formula C15H21ClN2
and a molecular weight of 264.80 g/mol. Its IUPAC name is 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine |
| PubChem CID | 84639810 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)(C)c1c(C)n(C)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H21ClN2/c1-10-14(15(2,3)9-17-4)12-7-6-11(16)8-13(12)18(10)5/h6-8,17H,9H2,1-5H3 |
| InChIKey | NUNITVZKYWELTO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine?
The IUPAC name of 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine (CID 84639810) is 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine.
What is the SMILES notation for 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine?
The canonical SMILES for 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine is CNCC(C)(C)c1c(C)n(C)c2cc(Cl)ccc12.
What is the InChIKey of 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine?
The InChIKey is NUNITVZKYWELTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClN2/c1-10-14(15(2,3)9-17-4)12-7-6-11(16)8-13(12)18(10)5/h6-8,17H,9H2,1-5H3.
What are the key properties of 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine?
2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine has a molecular weight of 264.80 g/mol, XLogP of 3.64, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-1,2-dimethylindol-3-yl)-N,2-dimethylpropan-1-amine is sourced from PubChem (CID 84639810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).