C12H15ClN2 — CID 82494517
1-(5-chloro-1,2-dimethylindol-3-yl)-N-methylmethanamine (PubChem CID 82494517) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 1-(5-chloro-1,2-dimethylindol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(5-chloro-1,2-dimethylindol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 82494517 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-(5-chloro-1,2-dimethylindol-3-yl)-N-methylmethanamine |
| SMILES | CNCc1c(C)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H15ClN2/c1-8-11(7-14-2)10-6-9(13)4-5-12(10)15(8)3/h4-6,14H,7H2,1-3H3 |
| InChIKey | BRNOUCABBFQDRW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|