C18H20N2 — CID 82501498
1-(1,2-dimethyl-5-phenylindol-3-yl)-N-methylmethanamine (PubChem CID 82501498) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(1,2-dimethyl-5-phenylindol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(1,2-dimethyl-5-phenylindol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 82501498 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(1,2-dimethyl-5-phenylindol-3-yl)-N-methylmethanamine |
| SMILES | CNCc1c(C)n(C)c2ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C18H20N2/c1-13-17(12-19-2)16-11-15(9-10-18(16)20(13)3)14-7-5-4-6-8-14/h4-11,19H,12H2,1-3H3 |
| InChIKey | JDVYIDUWNCSUAD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|