C15H19ClN2 — CID 82501198
N-[2-(5-chloro-1,2-dimethylindol-3-yl)ethyl]cyclopropanamine (PubChem CID 82501198) has the molecular formula C15H19ClN2 and a molecular weight of 262.78 g/mol. Its IUPAC name is N-[2-(5-chloro-1,2-dimethylindol-3-yl)ethyl]cyclopropanamine.
| Compound Name | N-[2-(5-chloro-1,2-dimethylindol-3-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 82501198 |
| Molecular Formula | C15H19ClN2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-[2-(5-chloro-1,2-dimethylindol-3-yl)ethyl]cyclopropanamine |
| SMILES | Cc1c(CCNC2CC2)c2cc(Cl)ccc2n1C |
| InChI | InChI=1S/C15H19ClN2/c1-10-13(7-8-17-12-4-5-12)14-9-11(16)3-6-15(14)18(10)2/h3,6,9,12,17H,4-5,7-8H2,1-2H3 |
| InChIKey | RCUPNWWFWGNIGX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|