About N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine
N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine (PubChem CID 82491124) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine |
| PubChem CID | 82491124 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine |
| SMILES | Cc1cc(CCNC2CC2)c(C)n1C |
| InChI | InChI=1S/C12H20N2/c1-9-8-11(10(2)14(9)3)6-7-13-12-4-5-12/h8,12-13H,4-7H2,1-3H3 |
| InChIKey | ZLFADZYKKOSRHW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine?
The IUPAC name of N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine (CID 82491124) is N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine.
What is the SMILES notation for N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine?
The canonical SMILES for N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine is Cc1cc(CCNC2CC2)c(C)n1C.
What is the InChIKey of N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine?
The InChIKey is ZLFADZYKKOSRHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-9-8-11(10(2)14(9)3)6-7-13-12-4-5-12/h8,12-13H,4-7H2,1-3H3.
What are the key properties of N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine?
N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine has a molecular weight of 192.31 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,2,5-trimethylpyrrol-3-yl)ethyl]cyclopropanamine is sourced from PubChem (CID 82491124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).