C10H18N2 — CID 82490467
N-methyl-2-(1,2,5-trimethylpyrrol-3-yl)ethanamine (PubChem CID 82490467) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-methyl-2-(1,2,5-trimethylpyrrol-3-yl)ethanamine.
| Compound Name | N-methyl-2-(1,2,5-trimethylpyrrol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82490467 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-methyl-2-(1,2,5-trimethylpyrrol-3-yl)ethanamine |
| SMILES | CNCCc1cc(C)n(C)c1C |
| InChI | InChI=1S/C10H18N2/c1-8-7-10(5-6-11-3)9(2)12(8)4/h7,11H,5-6H2,1-4H3 |
| InChIKey | LZGFJEBNNJWCBG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |