C12H22N2 — CID 96670635
N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)butan-1-amine (PubChem CID 96670635) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)butan-1-amine.
| Compound Name | N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)butan-1-amine |
|---|---|
| PubChem CID | 96670635 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-methyl-4-(1,2,5-trimethylpyrrol-3-yl)butan-1-amine |
| SMILES | CNCCCCc1cc(C)n(C)c1C |
| InChI | InChI=1S/C12H22N2/c1-10-9-12(11(2)14(10)4)7-5-6-8-13-3/h9,13H,5-8H2,1-4H3 |
| InChIKey | SGANHYFLXJNLLH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|