C18H26N2 — CID 96679061
N-[2-(1,2-dimethyl-5-propan-2-ylindol-3-yl)ethyl]cyclopropanamine (PubChem CID 96679061) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is N-[2-(1,2-dimethyl-5-propan-2-ylindol-3-yl)ethyl]cyclopropanamine.
| Compound Name | N-[2-(1,2-dimethyl-5-propan-2-ylindol-3-yl)ethyl]cyclopropanamine |
|---|---|
| PubChem CID | 96679061 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-[2-(1,2-dimethyl-5-propan-2-ylindol-3-yl)ethyl]cyclopropanamine |
| SMILES | Cc1c(CCNC2CC2)c2cc(C(C)C)ccc2n1C |
| InChI | InChI=1S/C18H26N2/c1-12(2)14-5-8-18-17(11-14)16(13(3)20(18)4)9-10-19-15-6-7-15/h5,8,11-12,15,19H,6-7,9-10H2,1-4H3 |
| InChIKey | VUVFVYHNJNIQKS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|