C15H21BrN2 — CID 84645259
3-(6-bromo-1,2-dimethylindol-3-yl)-3-methylbutan-1-amine (PubChem CID 84645259) has the molecular formula C15H21BrN2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 3-(6-bromo-1,2-dimethylindol-3-yl)-3-methylbutan-1-amine.
| Compound Name | 3-(6-bromo-1,2-dimethylindol-3-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 84645259 |
| Molecular Formula | C15H21BrN2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-(6-bromo-1,2-dimethylindol-3-yl)-3-methylbutan-1-amine |
| SMILES | Cc1c(C(C)(C)CCN)c2ccc(Br)cc2n1C |
| InChI | InChI=1S/C15H21BrN2/c1-10-14(15(2,3)7-8-17)12-6-5-11(16)9-13(12)18(10)4/h5-6,9H,7-8,17H2,1-4H3 |
| InChIKey | LETYHNRJAFDVSL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |