C12H15BrN2 — CID 83488858
2-(6-bromo-1,3-dimethylindol-2-yl)ethanamine (PubChem CID 83488858) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 2-(6-bromo-1,3-dimethylindol-2-yl)ethanamine.
| Compound Name | 2-(6-bromo-1,3-dimethylindol-2-yl)ethanamine |
|---|---|
| PubChem CID | 83488858 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 2-(6-bromo-1,3-dimethylindol-2-yl)ethanamine |
| SMILES | Cc1c(CCN)n(C)c2cc(Br)ccc12 |
| InChI | InChI=1S/C12H15BrN2/c1-8-10-4-3-9(13)7-12(10)15(2)11(8)5-6-14/h3-4,7H,5-6,14H2,1-2H3 |
| InChIKey | PNBBWGGWXRQPQM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|