C12H15BrN2 — CID 83866982
1-(5-bromo-1,3-dimethylindol-2-yl)-N-methylmethanamine (PubChem CID 83866982) has the molecular formula C12H15BrN2 and a molecular weight of 267.17 g/mol. Its IUPAC name is 1-(5-bromo-1,3-dimethylindol-2-yl)-N-methylmethanamine.
| Compound Name | 1-(5-bromo-1,3-dimethylindol-2-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 83866982 |
| Molecular Formula | C12H15BrN2 |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | 1-(5-bromo-1,3-dimethylindol-2-yl)-N-methylmethanamine |
| SMILES | CNCc1c(C)c2cc(Br)ccc2n1C |
| InChI | InChI=1S/C12H15BrN2/c1-8-10-6-9(13)4-5-11(10)15(3)12(8)7-14-2/h4-6,14H,7H2,1-3H3 |
| InChIKey | NUTOBVVLZKBQAF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|