C14H20N2 — CID 83859786
N-methyl-1-(1,3,5,7-tetramethylindol-2-yl)methanamine (PubChem CID 83859786) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is N-methyl-1-(1,3,5,7-tetramethylindol-2-yl)methanamine.
| Compound Name | N-methyl-1-(1,3,5,7-tetramethylindol-2-yl)methanamine |
|---|---|
| PubChem CID | 83859786 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | N-methyl-1-(1,3,5,7-tetramethylindol-2-yl)methanamine |
| SMILES | CNCc1c(C)c2cc(C)cc(C)c2n1C |
| InChI | InChI=1S/C14H20N2/c1-9-6-10(2)14-12(7-9)11(3)13(8-15-4)16(14)5/h6-7,15H,8H2,1-5H3 |
| InChIKey | XIQBZISZRJVKTB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|