C10H11BrN2O2 — CID 83903533
7-(2-aminoethyl)-5-bromo-3-methyl-1,3-benzoxazol-2-one (PubChem CID 83903533) has the molecular formula C10H11BrN2O2 and a molecular weight of 271.11 g/mol. Its IUPAC name is 7-(2-aminoethyl)-5-bromo-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 7-(2-aminoethyl)-5-bromo-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 83903533 |
| Molecular Formula | C10H11BrN2O2 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 7-(2-aminoethyl)-5-bromo-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2c(CCN)cc(Br)cc21 |
| InChI | InChI=1S/C10H11BrN2O2/c1-13-8-5-7(11)4-6(2-3-12)9(8)15-10(13)14/h4-5H,2-3,12H2,1H3 |
| InChIKey | QGJIEMHQDMFLIK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |