C7H9ClN2 — CID 58354941
6-chloro-N,4-dimethylpyridin-3-amine (PubChem CID 58354941) has the molecular formula C7H9ClN2 and a molecular weight of 156.62 g/mol. Its IUPAC name is 6-chloro-N,4-dimethylpyridin-3-amine.
| Compound Name | 6-chloro-N,4-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 58354941 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 6-chloro-N,4-dimethylpyridin-3-amine |
| SMILES | CNc1cnc(Cl)cc1C |
| InChI | InChI=1S/C7H9ClN2/c1-5-3-7(8)10-4-6(5)9-2/h3-4,9H,1-2H3 |
| InChIKey | AVVWQRARGVWOOX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|