C13H10Br2ClNO2 — CID 83269021
2-chloro-4-(2,5-dibromo-4-methoxyphenoxy)-5-methylpyridine (PubChem CID 83269021) has the molecular formula C13H10Br2ClNO2 and a molecular weight of 407.49 g/mol. Its IUPAC name is 2-chloro-4-(2,5-dibromo-4-methoxyphenoxy)-5-methylpyridine.
| Compound Name | 2-chloro-4-(2,5-dibromo-4-methoxyphenoxy)-5-methylpyridine |
|---|---|
| PubChem CID | 83269021 |
| Molecular Formula | C13H10Br2ClNO2 |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 404.88 |
| IUPAC Name | 2-chloro-4-(2,5-dibromo-4-methoxyphenoxy)-5-methylpyridine |
| SMILES | COc1cc(Br)c(Oc2cc(Cl)ncc2C)cc1Br |
| InChI | InChI=1S/C13H10Br2ClNO2/c1-7-6-17-13(16)5-10(7)19-12-4-8(14)11(18-2)3-9(12)15/h3-6H,1-2H3 |
| InChIKey | RFJQLZLSRAXDMD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|