C11H7Br2ClN2O2 — CID 79416501
3-chloro-6-(2,5-dibromo-4-methoxyphenoxy)pyridazine (PubChem CID 79416501) has the molecular formula C11H7Br2ClN2O2 and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-chloro-6-(2,5-dibromo-4-methoxyphenoxy)pyridazine.
| Compound Name | 3-chloro-6-(2,5-dibromo-4-methoxyphenoxy)pyridazine |
|---|---|
| PubChem CID | 79416501 |
| Molecular Formula | C11H7Br2ClN2O2 |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 391.86 |
| IUPAC Name | 3-chloro-6-(2,5-dibromo-4-methoxyphenoxy)pyridazine |
| SMILES | COc1cc(Br)c(Oc2ccc(Cl)nn2)cc1Br |
| InChI | InChI=1S/C11H7Br2ClN2O2/c1-17-8-4-7(13)9(5-6(8)12)18-11-3-2-10(14)15-16-11/h2-5H,1H3 |
| InChIKey | CKWIBMAHKQRUTG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |