C12H9Br2ClN2O2 — CID 103054885
2-chloro-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]pyrazine (PubChem CID 103054885) has the molecular formula C12H9Br2ClN2O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-chloro-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]pyrazine.
| Compound Name | 2-chloro-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]pyrazine |
|---|---|
| PubChem CID | 103054885 |
| Molecular Formula | C12H9Br2ClN2O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 405.87 |
| IUPAC Name | 2-chloro-5-[(2,5-dibromo-4-methoxyphenoxy)methyl]pyrazine |
| SMILES | COc1cc(Br)c(OCc2cnc(Cl)cn2)cc1Br |
| InChI | InChI=1S/C12H9Br2ClN2O2/c1-18-10-2-9(14)11(3-8(10)13)19-6-7-4-17-12(15)5-16-7/h2-5H,6H2,1H3 |
| InChIKey | WNOLCTRMEAOCNS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |