C14H20ClN3O2Si — CID 174049229
[6-chloro-3-[2-[2,2-dimethylpropyl(dimethyl)silyl]ethynyl]pyridazin-4-yl]carbamic acid (PubChem CID 174049229) has the molecular formula C14H20ClN3O2Si and a molecular weight of 325.87 g/mol. Its IUPAC name is [6-chloro-3-[2-[2,2-dimethylpropyl(dimethyl)silyl]ethynyl]pyridazin-4-yl]carbamic acid.
| Compound Name | [6-chloro-3-[2-[2,2-dimethylpropyl(dimethyl)silyl]ethynyl]pyridazin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 174049229 |
| Molecular Formula | C14H20ClN3O2Si |
| Molecular Weight | 325.87 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | [6-chloro-3-[2-[2,2-dimethylpropyl(dimethyl)silyl]ethynyl]pyridazin-4-yl]carbamic acid |
| SMILES | CC(C)(C)C[Si](C)(C)C#Cc1nnc(Cl)cc1NC(=O)O |
| InChI | InChI=1S/C14H20ClN3O2Si/c1-14(2,3)9-21(4,5)7-6-10-11(16-13(19)20)8-12(15)18-17-10/h8H,9H2,1-5H3,(H,16,18)(H,19,20) |
| InChIKey | RAFKJHHWCQZQBM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.87 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|