C10H13Cl2N3O2 — CID 135393300
2-[(3,6-dichloropyridazin-4-yl)amino]-3-methylpentanoic acid (PubChem CID 135393300) has the molecular formula C10H13Cl2N3O2 and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-[(3,6-dichloropyridazin-4-yl)amino]-3-methylpentanoic acid.
| Compound Name | 2-[(3,6-dichloropyridazin-4-yl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 135393300 |
| Molecular Formula | C10H13Cl2N3O2 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 2-[(3,6-dichloropyridazin-4-yl)amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(Nc1cc(Cl)nnc1Cl)C(=O)O |
| InChI | InChI=1S/C10H13Cl2N3O2/c1-3-5(2)8(10(16)17)13-6-4-7(11)14-15-9(6)12/h4-5,8H,3H2,1-2H3,(H,13,14)(H,16,17) |
| InChIKey | ZEBFGHNQHWJDIY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |