C14H23N3O2 — CID 122050557
(2S,3S)-2-[(4,6-diethylpyrimidin-2-yl)amino]-3-methylpentanoic acid (PubChem CID 122050557) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (2S,3S)-2-[(4,6-diethylpyrimidin-2-yl)amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(4,6-diethylpyrimidin-2-yl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 122050557 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (2S,3S)-2-[(4,6-diethylpyrimidin-2-yl)amino]-3-methylpentanoic acid |
| SMILES | CCc1cc(CC)nc(N[C@H](C(=O)O)[C@@H](C)CC)n1 |
| InChI | InChI=1S/C14H23N3O2/c1-5-9(4)12(13(18)19)17-14-15-10(6-2)8-11(7-3)16-14/h8-9,12H,5-7H2,1-4H3,(H,18,19)(H,15,16,17)/t9-,12-/m0/s1 |
| InChIKey | KSLLHDRTQFSSMC-CABZTGNLSA-N |
| XLogP | 2.51 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |