C13H19NO4S — CID 122050364
(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid (PubChem CID 122050364) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid |
|---|---|
| PubChem CID | 122050364 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid |
| SMILES | CC[C@H](C)[C@H](Nc1ccc(S(C)(=O)=O)cc1)C(=O)O |
| InChI | InChI=1S/C13H19NO4S/c1-4-9(2)12(13(15)16)14-10-5-7-11(8-6-10)19(3,17)18/h5-9,12,14H,4H2,1-3H3,(H,15,16)/t9-,12-/m0/s1 |
| InChIKey | XIUVTBBFRMYIJQ-CABZTGNLSA-N |
| XLogP | 2.00 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |