(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid

C13H19NO4S — CID 122050364

IUPAC(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid
SMILESCC[C@H](C)[C@H](Nc1ccc(S(C)(=O)=O)cc1)C(=O)O
InChIInChI=1S/C13H19NO4S/c1-4-9(2)12(13(15)16)14-10-5-7-11(8-6-10)19(3,17)18/h5-9,12,14H,4H2,1-3H3,(H,15,16)/t9-,12-/m0/s1
InChIKeyXIUVTBBFRMYIJQ-CABZTGNLSA-N
MW285.37 g/mol
LogP2.00
Rot. Bonds6

About (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid

(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid (PubChem CID 122050364) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid.

Molecular Properties

Compound Name(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid
PubChem CID122050364
Molecular FormulaC13H19NO4S
Molecular Weight285.37 g/mol
Exact Mass285.10
IUPAC Name(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid
SMILESCC[C@H](C)[C@H](Nc1ccc(S(C)(=O)=O)cc1)C(=O)O
InChIInChI=1S/C13H19NO4S/c1-4-9(2)12(13(15)16)14-10-5-7-11(8-6-10)19(3,17)18/h5-9,12,14H,4H2,1-3H3,(H,15,16)/t9-,12-/m0/s1
InChIKeyXIUVTBBFRMYIJQ-CABZTGNLSA-N
XLogP2.00
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500285.37
LogP ≤ 52.00
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid?
The IUPAC name of (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid (CID 122050364) is (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid.
What is the SMILES notation for (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid?
The canonical SMILES for (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid is CC[C@H](C)[C@H](Nc1ccc(S(C)(=O)=O)cc1)C(=O)O.
What is the InChIKey of (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid?
The InChIKey is XIUVTBBFRMYIJQ-CABZTGNLSA-N. The full InChI is InChI=1S/C13H19NO4S/c1-4-9(2)12(13(15)16)14-10-5-7-11(8-6-10)19(3,17)18/h5-9,12,14H,4H2,1-3H3,(H,15,16)/t9-,12-/m0/s1.
What are the key properties of (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid?
(2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid has a molecular weight of 285.37 g/mol, XLogP of 2.00, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-3-methyl-2-(4-methylsulfonylanilino)pentanoic acid is sourced from PubChem (CID 122050364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).