C15H21NO6S — CID 120686652
2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]-3-methylpentanoic acid (PubChem CID 120686652) has the molecular formula C15H21NO6S and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]-3-methylpentanoic acid.
| Compound Name | 2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 120686652 |
| Molecular Formula | C15H21NO6S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 2-[(2-methoxy-5-methylsulfonylbenzoyl)amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)c1cc(S(C)(=O)=O)ccc1OC)C(=O)O |
| InChI | InChI=1S/C15H21NO6S/c1-5-9(2)13(15(18)19)16-14(17)11-8-10(23(4,20)21)6-7-12(11)22-3/h6-9,13H,5H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | LUEVANDBQJPXTR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |