C19H21NO6S — CID 120690055
3-[4-[(2-methoxy-5-methylsulfonylbenzoyl)amino]phenyl]-2-methylpropanoic acid (PubChem CID 120690055) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-[4-[(2-methoxy-5-methylsulfonylbenzoyl)amino]phenyl]-2-methylpropanoic acid.
| Compound Name | 3-[4-[(2-methoxy-5-methylsulfonylbenzoyl)amino]phenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 120690055 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-[4-[(2-methoxy-5-methylsulfonylbenzoyl)amino]phenyl]-2-methylpropanoic acid |
| SMILES | COc1ccc(S(C)(=O)=O)cc1C(=O)Nc1ccc(CC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H21NO6S/c1-12(19(22)23)10-13-4-6-14(7-5-13)20-18(21)16-11-15(27(3,24)25)8-9-17(16)26-2/h4-9,11-12H,10H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | ZVQAXRINGRUXCI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |