C13H6Cl2F2N2O3 — CID 175875300
[5,6-dichloro-4-(2,6-difluorobenzoyl)-3-pyridinyl]carbamic acid (PubChem CID 175875300) has the molecular formula C13H6Cl2F2N2O3 and a molecular weight of 347.10 g/mol. Its IUPAC name is [5,6-dichloro-4-(2,6-difluorobenzoyl)-3-pyridinyl]carbamic acid.
| Compound Name | [5,6-dichloro-4-(2,6-difluorobenzoyl)-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 175875300 |
| Molecular Formula | C13H6Cl2F2N2O3 |
| Molecular Weight | 347.10 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | [5,6-dichloro-4-(2,6-difluorobenzoyl)-3-pyridinyl]carbamic acid |
| SMILES | O=C(O)Nc1cnc(Cl)c(Cl)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H6Cl2F2N2O3/c14-10-9(7(19-13(21)22)4-18-12(10)15)11(20)8-5(16)2-1-3-6(8)17/h1-4,19H,(H,21,22) |
| InChIKey | RYDDATCBHXUTIP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.10 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|