About (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide
(2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide (PubChem CID 171486470) has the molecular formula C15H11F4N3O2
and a molecular weight of 341.26 g/mol. Its IUPAC name is (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide |
| PubChem CID | 171486470 |
| Molecular Formula | C15H11F4N3O2 |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide |
| SMILES | C[C@H](N)C(=O)Nc1cnc(F)c(F)c1C(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C15H11F4N3O2/c1-6(20)15(24)22-9-5-21-14(19)12(18)11(9)13(23)10-7(16)3-2-4-8(10)17/h2-6H,20H2,1H3,(H,22,24)/t6-/m0/s1 |
| InChIKey | IISRDSJKLGTHJP-LURJTMIESA-N |
| XLogP | 2.15 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide?
The IUPAC name of (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide (CID 171486470) is (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide.
What is the SMILES notation for (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide?
The canonical SMILES for (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide is C[C@H](N)C(=O)Nc1cnc(F)c(F)c1C(=O)c1c(F)cccc1F.
What is the InChIKey of (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide?
The InChIKey is IISRDSJKLGTHJP-LURJTMIESA-N. The full InChI is InChI=1S/C15H11F4N3O2/c1-6(20)15(24)22-9-5-21-14(19)12(18)11(9)13(23)10-7(16)3-2-4-8(10)17/h2-6H,20H2,1H3,(H,22,24)/t6-/m0/s1.
What are the key properties of (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide?
(2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide has a molecular weight of 341.26 g/mol, XLogP of 2.15, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-N-[4-(2,6-difluorobenzoyl)-5,6-difluoro-3-pyridinyl]propanamide is sourced from PubChem (CID 171486470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).