C16H20F2N6OS — CID 137067759
N'-amino-4-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]-2-(methylamino)-1H-pyrrole-3-carboximidamide (PubChem CID 137067759) has the molecular formula C16H20F2N6OS and a molecular weight of 382.44 g/mol. Its IUPAC name is N'-amino-4-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]-2-(methylamino)-1H-pyrrole-3-carboximidamide.
| Compound Name | N'-amino-4-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]-2-(methylamino)-1H-pyrrole-3-carboximidamide |
|---|---|
| PubChem CID | 137067759 |
| Molecular Formula | C16H20F2N6OS |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | N'-amino-4-[2,6-difluoro-3-(propylsulfanylamino)benzoyl]-2-(methylamino)-1H-pyrrole-3-carboximidamide |
| SMILES | CCCSNc1ccc(F)c(C(=O)c2c[nH]c(NC)c2/C(N)=N/N)c1F |
| InChI | InChI=1S/C16H20F2N6OS/c1-3-6-26-24-10-5-4-9(17)12(13(10)18)14(25)8-7-22-16(21-2)11(8)15(19)23-20/h4-5,7,21-22,24H,3,6,20H2,1-2H3,(H2,19,23) |
| InChIKey | LLHSYCYPXFOVLC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 121.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|