C23H28F2N6OS — CID 126731443
[2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-[(1-ethylpiperidin-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone (PubChem CID 126731443) has the molecular formula C23H28F2N6OS and a molecular weight of 474.58 g/mol. Its IUPAC name is [2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-[(1-ethylpiperidin-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone.
| Compound Name | [2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-[(1-ethylpiperidin-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 126731443 |
| Molecular Formula | C23H28F2N6OS |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | [2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-[(1-ethylpiperidin-4-yl)amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
| SMILES | CCCSNc1ccc(F)c(C(=O)c2c[nH]c3ncnc(NC4CCN(CC)CC4)c23)c1F |
| InChI | InChI=1S/C23H28F2N6OS/c1-3-11-33-30-17-6-5-16(24)19(20(17)25)21(32)15-12-26-22-18(15)23(28-13-27-22)29-14-7-9-31(4-2)10-8-14/h5-6,12-14,30H,3-4,7-11H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | ZXENKLXFQQDZPC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|