C19H19F2N5O2S — CID 126731433
[2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-(oxetan-3-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone (PubChem CID 126731433) has the molecular formula C19H19F2N5O2S and a molecular weight of 419.46 g/mol. Its IUPAC name is [2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-(oxetan-3-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone.
| Compound Name | [2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-(oxetan-3-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
|---|---|
| PubChem CID | 126731433 |
| Molecular Formula | C19H19F2N5O2S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | [2,6-difluoro-3-(propylsulfanylamino)phenyl]-[4-(oxetan-3-ylamino)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]methanone |
| SMILES | CCCSNc1ccc(F)c(C(=O)c2c[nH]c3ncnc(NC4COC4)c23)c1F |
| InChI | InChI=1S/C19H19F2N5O2S/c1-2-5-29-26-13-4-3-12(20)15(16(13)21)17(27)11-6-22-18-14(11)19(24-9-23-18)25-10-7-28-8-10/h3-4,6,9-10,26H,2,5,7-8H2,1H3,(H2,22,23,24,25) |
| InChIKey | IDRBMVHKCMOPEF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|